C11H14N2O — CID 129139598
6-(aminomethyl)-2-methyl-3,4-dihydroisoquinolin-1-one (PubChem CID 129139598) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is 6-(aminomethyl)-2-methyl-3,4-dihydroisoquinolin-1-one.
| Compound Name | 6-(aminomethyl)-2-methyl-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 129139598 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 6-(aminomethyl)-2-methyl-3,4-dihydroisoquinolin-1-one |
| SMILES | CN1CCc2cc(CN)ccc2C1=O |
| InChI | InChI=1S/C11H14N2O/c1-13-5-4-9-6-8(7-12)2-3-10(9)11(13)14/h2-3,6H,4-5,7,12H2,1H3 |
| InChIKey | LUZHTOKPVJEJKQ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |