C10H12N2O — CID 82503449
5-(aminomethyl)-2,3-dihydroindole-1-carbaldehyde (PubChem CID 82503449) has the molecular formula C10H12N2O and a molecular weight of 176.22 g/mol. Its IUPAC name is 5-(aminomethyl)-2,3-dihydroindole-1-carbaldehyde.
| Compound Name | 5-(aminomethyl)-2,3-dihydroindole-1-carbaldehyde |
|---|---|
| PubChem CID | 82503449 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 5-(aminomethyl)-2,3-dihydroindole-1-carbaldehyde |
| SMILES | NCc1ccc2c(c1)CCN2C=O |
| InChI | InChI=1S/C10H12N2O/c11-6-8-1-2-10-9(5-8)3-4-12(10)7-13/h1-2,5,7H,3-4,6,11H2 |
| InChIKey | ZPBJTTNJXXNBOI-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|