C10H9NO3 — CID 61147748
1-formyl-2,3-dihydroindole-5-carboxylic acid (PubChem CID 61147748) has the molecular formula C10H9NO3 and a molecular weight of 191.19 g/mol. Its IUPAC name is 1-formyl-2,3-dihydroindole-5-carboxylic acid.
| Compound Name | 1-formyl-2,3-dihydroindole-5-carboxylic acid |
|---|---|
| PubChem CID | 61147748 |
| Molecular Formula | C10H9NO3 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | 1-formyl-2,3-dihydroindole-5-carboxylic acid |
| SMILES | O=CN1CCc2cc(C(=O)O)ccc21 |
| InChI | InChI=1S/C10H9NO3/c12-6-11-4-3-7-5-8(10(13)14)1-2-9(7)11/h1-2,5-6H,3-4H2,(H,13,14) |
| InChIKey | DBRXANTZLJDAJM-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|