C15H19NO4S — CID 61066001
1-cyclohexylsulfonyl-2,3-dihydroindole-5-carboxylic acid (PubChem CID 61066001) has the molecular formula C15H19NO4S and a molecular weight of 309.39 g/mol. Its IUPAC name is 1-cyclohexylsulfonyl-2,3-dihydroindole-5-carboxylic acid.
| Compound Name | 1-cyclohexylsulfonyl-2,3-dihydroindole-5-carboxylic acid |
|---|---|
| PubChem CID | 61066001 |
| Molecular Formula | C15H19NO4S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 1-cyclohexylsulfonyl-2,3-dihydroindole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)CCN2S(=O)(=O)C1CCCCC1 |
| InChI | InChI=1S/C15H19NO4S/c17-15(18)12-6-7-14-11(10-12)8-9-16(14)21(19,20)13-4-2-1-3-5-13/h6-7,10,13H,1-5,8-9H2,(H,17,18) |
| InChIKey | MFASMTZZXDCECF-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |