C13H10BrNO4S2 — CID 61062442
1-(3-bromothiophen-2-yl)sulfonyl-2,3-dihydroindole-5-carboxylic acid (PubChem CID 61062442) has the molecular formula C13H10BrNO4S2 and a molecular weight of 388.26 g/mol. Its IUPAC name is 1-(3-bromothiophen-2-yl)sulfonyl-2,3-dihydroindole-5-carboxylic acid.
| Compound Name | 1-(3-bromothiophen-2-yl)sulfonyl-2,3-dihydroindole-5-carboxylic acid |
|---|---|
| PubChem CID | 61062442 |
| Molecular Formula | C13H10BrNO4S2 |
| Molecular Weight | 388.26 g/mol |
| Exact Mass | 386.92 |
| IUPAC Name | 1-(3-bromothiophen-2-yl)sulfonyl-2,3-dihydroindole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)CCN2S(=O)(=O)c1sccc1Br |
| InChI | InChI=1S/C13H10BrNO4S2/c14-10-4-6-20-13(10)21(18,19)15-5-3-8-7-9(12(16)17)1-2-11(8)15/h1-2,4,6-7H,3,5H2,(H,16,17) |
| InChIKey | MSSAFUCVAWJTSX-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.26 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |