C21H17BrN2O3S — CID 46262940
1-(4-bromophenyl)sulfonyl-N-phenyl-2,3-dihydroindole-5-carboxamide (PubChem CID 46262940) has the molecular formula C21H17BrN2O3S and a molecular weight of 457.35 g/mol. Its IUPAC name is 1-(4-bromophenyl)sulfonyl-N-phenyl-2,3-dihydroindole-5-carboxamide.
| Compound Name | 1-(4-bromophenyl)sulfonyl-N-phenyl-2,3-dihydroindole-5-carboxamide |
|---|---|
| PubChem CID | 46262940 |
| Molecular Formula | C21H17BrN2O3S |
| Molecular Weight | 457.35 g/mol |
| Exact Mass | 456.01 |
| IUPAC Name | 1-(4-bromophenyl)sulfonyl-N-phenyl-2,3-dihydroindole-5-carboxamide |
| SMILES | O=C(Nc1ccccc1)c1ccc2c(c1)CCN2S(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C21H17BrN2O3S/c22-17-7-9-19(10-8-17)28(26,27)24-13-12-15-14-16(6-11-20(15)24)21(25)23-18-4-2-1-3-5-18/h1-11,14H,12-13H2,(H,23,25) |
| InChIKey | GHPOFXBGDPAZGY-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.35 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |