C21H18N2O3S — CID 2704832
3-(2,3-dihydroindol-1-ylsulfonyl)-N-phenylbenzamide (PubChem CID 2704832) has the molecular formula C21H18N2O3S and a molecular weight of 378.45 g/mol. Its IUPAC name is 3-(2,3-dihydroindol-1-ylsulfonyl)-N-phenylbenzamide.
| Compound Name | 3-(2,3-dihydroindol-1-ylsulfonyl)-N-phenylbenzamide |
|---|---|
| PubChem CID | 2704832 |
| Molecular Formula | C21H18N2O3S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | 3-(2,3-dihydroindol-1-ylsulfonyl)-N-phenylbenzamide |
| SMILES | O=C(Nc1ccccc1)c1cccc(S(=O)(=O)N2CCc3ccccc32)c1 |
| InChI | InChI=1S/C21H18N2O3S/c24-21(22-18-9-2-1-3-10-18)17-8-6-11-19(15-17)27(25,26)23-14-13-16-7-4-5-12-20(16)23/h1-12,15H,13-14H2,(H,22,24) |
| InChIKey | JAZFJBPVGUDVNN-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |