C15H12NO4S- — CID 7062520
3-(2,3-dihydroindol-1-ylsulfonyl)benzoate (PubChem CID 7062520) has the molecular formula C15H12NO4S- and a molecular weight of 302.33 g/mol. Its IUPAC name is 3-(2,3-dihydroindol-1-ylsulfonyl)benzoate.
| Compound Name | 3-(2,3-dihydroindol-1-ylsulfonyl)benzoate |
|---|---|
| PubChem CID | 7062520 |
| Molecular Formula | C15H12NO4S- |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 3-(2,3-dihydroindol-1-ylsulfonyl)benzoate |
| SMILES | O=C([O-])c1cccc(S(=O)(=O)N2CCc3ccccc32)c1 |
| InChI | InChI=1S/C15H13NO4S/c17-15(18)12-5-3-6-13(10-12)21(19,20)16-9-8-11-4-1-2-7-14(11)16/h1-7,10H,8-9H2,(H,17,18)/p-1 |
| InChIKey | VLBSLQVQWAJURT-UHFFFAOYSA-M |
| XLogP | 0.80 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |