C22H19NO5S — CID 8881484
(4-methoxyphenyl) 3-(2,3-dihydroindol-1-ylsulfonyl)benzoate (PubChem CID 8881484) has the molecular formula C22H19NO5S and a molecular weight of 409.46 g/mol. Its IUPAC name is (4-methoxyphenyl) 3-(2,3-dihydroindol-1-ylsulfonyl)benzoate.
| Compound Name | (4-methoxyphenyl) 3-(2,3-dihydroindol-1-ylsulfonyl)benzoate |
|---|---|
| PubChem CID | 8881484 |
| Molecular Formula | C22H19NO5S |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | (4-methoxyphenyl) 3-(2,3-dihydroindol-1-ylsulfonyl)benzoate |
| SMILES | COc1ccc(OC(=O)c2cccc(S(=O)(=O)N3CCc4ccccc43)c2)cc1 |
| InChI | InChI=1S/C22H19NO5S/c1-27-18-9-11-19(12-10-18)28-22(24)17-6-4-7-20(15-17)29(25,26)23-14-13-16-5-2-3-8-21(16)23/h2-12,15H,13-14H2,1H3 |
| InChIKey | PGEJEMZHPIBJQO-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|