C25H24N2O7S — CID 2642201
[2-(3,5-dimethoxyanilino)-2-oxoethyl] 3-(2,3-dihydroindol-1-ylsulfonyl)benzoate (PubChem CID 2642201) has the molecular formula C25H24N2O7S and a molecular weight of 496.54 g/mol. Its IUPAC name is [2-(3,5-dimethoxyanilino)-2-oxoethyl] 3-(2,3-dihydroindol-1-ylsulfonyl)benzoate.
| Compound Name | [2-(3,5-dimethoxyanilino)-2-oxoethyl] 3-(2,3-dihydroindol-1-ylsulfonyl)benzoate |
|---|---|
| PubChem CID | 2642201 |
| Molecular Formula | C25H24N2O7S |
| Molecular Weight | 496.54 g/mol |
| Exact Mass | 496.13 |
| IUPAC Name | [2-(3,5-dimethoxyanilino)-2-oxoethyl] 3-(2,3-dihydroindol-1-ylsulfonyl)benzoate |
| SMILES | COc1cc(NC(=O)COC(=O)c2cccc(S(=O)(=O)N3CCc4ccccc43)c2)cc(OC)c1 |
| InChI | InChI=1S/C25H24N2O7S/c1-32-20-13-19(14-21(15-20)33-2)26-24(28)16-34-25(29)18-7-5-8-22(12-18)35(30,31)27-11-10-17-6-3-4-9-23(17)27/h3-9,12-15H,10-11,16H2,1-2H3,(H,26,28) |
| InChIKey | ZTODDJWMQRBLDJ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.54 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |