C18H18N2O5S — CID 8663402
[2-(methylamino)-2-oxoethyl] 3-(2,3-dihydroindol-1-ylsulfonyl)benzoate (PubChem CID 8663402) has the molecular formula C18H18N2O5S and a molecular weight of 374.42 g/mol. Its IUPAC name is [2-(methylamino)-2-oxoethyl] 3-(2,3-dihydroindol-1-ylsulfonyl)benzoate.
| Compound Name | [2-(methylamino)-2-oxoethyl] 3-(2,3-dihydroindol-1-ylsulfonyl)benzoate |
|---|---|
| PubChem CID | 8663402 |
| Molecular Formula | C18H18N2O5S |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | [2-(methylamino)-2-oxoethyl] 3-(2,3-dihydroindol-1-ylsulfonyl)benzoate |
| SMILES | CNC(=O)COC(=O)c1cccc(S(=O)(=O)N2CCc3ccccc32)c1 |
| InChI | InChI=1S/C18H18N2O5S/c1-19-17(21)12-25-18(22)14-6-4-7-15(11-14)26(23,24)20-10-9-13-5-2-3-8-16(13)20/h2-8,11H,9-10,12H2,1H3,(H,19,21) |
| InChIKey | OUDXPZBWOBZDCU-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |