C25H24N2O6S — CID 29141875
[2-(2-ethoxyanilino)-2-oxoethyl] 3-(2,3-dihydroindol-1-ylsulfonyl)benzoate (PubChem CID 29141875) has the molecular formula C25H24N2O6S and a molecular weight of 480.54 g/mol. Its IUPAC name is [2-(2-ethoxyanilino)-2-oxoethyl] 3-(2,3-dihydroindol-1-ylsulfonyl)benzoate.
| Compound Name | [2-(2-ethoxyanilino)-2-oxoethyl] 3-(2,3-dihydroindol-1-ylsulfonyl)benzoate |
|---|---|
| PubChem CID | 29141875 |
| Molecular Formula | C25H24N2O6S |
| Molecular Weight | 480.54 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | [2-(2-ethoxyanilino)-2-oxoethyl] 3-(2,3-dihydroindol-1-ylsulfonyl)benzoate |
| SMILES | CCOc1ccccc1NC(=O)COC(=O)c1cccc(S(=O)(=O)N2CCc3ccccc32)c1 |
| InChI | InChI=1S/C25H24N2O6S/c1-2-32-23-13-6-4-11-21(23)26-24(28)17-33-25(29)19-9-7-10-20(16-19)34(30,31)27-15-14-18-8-3-5-12-22(18)27/h3-13,16H,2,14-15,17H2,1H3,(H,26,28) |
| InChIKey | KUMRXXGNNSLMIO-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.54 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |