C18H17NO5S — CID 5122086
2-oxopropyl 3-(2,3-dihydroindol-1-ylsulfonyl)benzoate (PubChem CID 5122086) has the molecular formula C18H17NO5S and a molecular weight of 359.40 g/mol. Its IUPAC name is 2-oxopropyl 3-(2,3-dihydroindol-1-ylsulfonyl)benzoate.
| Compound Name | 2-oxopropyl 3-(2,3-dihydroindol-1-ylsulfonyl)benzoate |
|---|---|
| PubChem CID | 5122086 |
| Molecular Formula | C18H17NO5S |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | 2-oxopropyl 3-(2,3-dihydroindol-1-ylsulfonyl)benzoate |
| SMILES | CC(=O)COC(=O)c1cccc(S(=O)(=O)N2CCc3ccccc32)c1 |
| InChI | InChI=1S/C18H17NO5S/c1-13(20)12-24-18(21)15-6-4-7-16(11-15)25(22,23)19-10-9-14-5-2-3-8-17(14)19/h2-8,11H,9-10,12H2,1H3 |
| InChIKey | NBHJNIFEFHOFBC-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |