C22H17Cl2NO4S — CID 2406084
(2,6-dichlorophenyl)methyl 3-(2,3-dihydroindol-1-ylsulfonyl)benzoate (PubChem CID 2406084) has the molecular formula C22H17Cl2NO4S and a molecular weight of 462.35 g/mol. Its IUPAC name is (2,6-dichlorophenyl)methyl 3-(2,3-dihydroindol-1-ylsulfonyl)benzoate.
| Compound Name | (2,6-dichlorophenyl)methyl 3-(2,3-dihydroindol-1-ylsulfonyl)benzoate |
|---|---|
| PubChem CID | 2406084 |
| Molecular Formula | C22H17Cl2NO4S |
| Molecular Weight | 462.35 g/mol |
| Exact Mass | 461.03 |
| IUPAC Name | (2,6-dichlorophenyl)methyl 3-(2,3-dihydroindol-1-ylsulfonyl)benzoate |
| SMILES | O=C(OCc1c(Cl)cccc1Cl)c1cccc(S(=O)(=O)N2CCc3ccccc32)c1 |
| InChI | InChI=1S/C22H17Cl2NO4S/c23-19-8-4-9-20(24)18(19)14-29-22(26)16-6-3-7-17(13-16)30(27,28)25-12-11-15-5-1-2-10-21(15)25/h1-10,13H,11-12,14H2 |
| InChIKey | NPDWBJUUDWGZTA-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.35 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |