C23H19NO6S — CID 2115188
1,3-benzodioxol-5-ylmethyl 3-(2,3-dihydroindol-1-ylsulfonyl)benzoate (PubChem CID 2115188) has the molecular formula C23H19NO6S and a molecular weight of 437.47 g/mol. Its IUPAC name is 1,3-benzodioxol-5-ylmethyl 3-(2,3-dihydroindol-1-ylsulfonyl)benzoate.
| Compound Name | 1,3-benzodioxol-5-ylmethyl 3-(2,3-dihydroindol-1-ylsulfonyl)benzoate |
|---|---|
| PubChem CID | 2115188 |
| Molecular Formula | C23H19NO6S |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | 1,3-benzodioxol-5-ylmethyl 3-(2,3-dihydroindol-1-ylsulfonyl)benzoate |
| SMILES | O=C(OCc1ccc2c(c1)OCO2)c1cccc(S(=O)(=O)N2CCc3ccccc32)c1 |
| InChI | InChI=1S/C23H19NO6S/c25-23(28-14-16-8-9-21-22(12-16)30-15-29-21)18-5-3-6-19(13-18)31(26,27)24-11-10-17-4-1-2-7-20(17)24/h1-9,12-13H,10-11,14-15H2 |
| InChIKey | UXTDFZZZBQRHLK-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |