C24H20N4O4S — CID 27913355
(4-aminoquinazolin-2-yl)methyl 3-(2,3-dihydroindol-1-ylsulfonyl)benzoate (PubChem CID 27913355) has the molecular formula C24H20N4O4S and a molecular weight of 460.52 g/mol. Its IUPAC name is (4-aminoquinazolin-2-yl)methyl 3-(2,3-dihydroindol-1-ylsulfonyl)benzoate.
| Compound Name | (4-aminoquinazolin-2-yl)methyl 3-(2,3-dihydroindol-1-ylsulfonyl)benzoate |
|---|---|
| PubChem CID | 27913355 |
| Molecular Formula | C24H20N4O4S |
| Molecular Weight | 460.52 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | (4-aminoquinazolin-2-yl)methyl 3-(2,3-dihydroindol-1-ylsulfonyl)benzoate |
| SMILES | Nc1nc(COC(=O)c2cccc(S(=O)(=O)N3CCc4ccccc43)c2)nc2ccccc12 |
| InChI | InChI=1S/C24H20N4O4S/c25-23-19-9-2-3-10-20(19)26-22(27-23)15-32-24(29)17-7-5-8-18(14-17)33(30,31)28-13-12-16-6-1-4-11-21(16)28/h1-11,14H,12-13,15H2,(H2,25,26,27) |
| InChIKey | LSOWYGMWINUOHC-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 115.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.52 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |