C28H21NO5S — CID 2407728
(4-benzoylphenyl) 3-(2,3-dihydroindol-1-ylsulfonyl)benzoate (PubChem CID 2407728) has the molecular formula C28H21NO5S and a molecular weight of 483.55 g/mol. Its IUPAC name is (4-benzoylphenyl) 3-(2,3-dihydroindol-1-ylsulfonyl)benzoate.
| Compound Name | (4-benzoylphenyl) 3-(2,3-dihydroindol-1-ylsulfonyl)benzoate |
|---|---|
| PubChem CID | 2407728 |
| Molecular Formula | C28H21NO5S |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.11 |
| IUPAC Name | (4-benzoylphenyl) 3-(2,3-dihydroindol-1-ylsulfonyl)benzoate |
| SMILES | O=C(Oc1ccc(C(=O)c2ccccc2)cc1)c1cccc(S(=O)(=O)N2CCc3ccccc32)c1 |
| InChI | InChI=1S/C28H21NO5S/c30-27(21-8-2-1-3-9-21)22-13-15-24(16-14-22)34-28(31)23-10-6-11-25(19-23)35(32,33)29-18-17-20-7-4-5-12-26(20)29/h1-16,19H,17-18H2 |
| InChIKey | OSDQDYYASULRQR-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|