C24H23N3O4S — CID 55549519
N-(2-benzamidoethyl)-3-(2,3-dihydroindol-1-ylsulfonyl)benzamide (PubChem CID 55549519) has the molecular formula C24H23N3O4S and a molecular weight of 449.53 g/mol. Its IUPAC name is N-(2-benzamidoethyl)-3-(2,3-dihydroindol-1-ylsulfonyl)benzamide.
| Compound Name | N-(2-benzamidoethyl)-3-(2,3-dihydroindol-1-ylsulfonyl)benzamide |
|---|---|
| PubChem CID | 55549519 |
| Molecular Formula | C24H23N3O4S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | N-(2-benzamidoethyl)-3-(2,3-dihydroindol-1-ylsulfonyl)benzamide |
| SMILES | O=C(NCCNC(=O)c1cccc(S(=O)(=O)N2CCc3ccccc32)c1)c1ccccc1 |
| InChI | InChI=1S/C24H23N3O4S/c28-23(19-8-2-1-3-9-19)25-14-15-26-24(29)20-10-6-11-21(17-20)32(30,31)27-16-13-18-7-4-5-12-22(18)27/h1-12,17H,13-16H2,(H,25,28)(H,26,29) |
| InChIKey | AKTOHWHNPVJMMP-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|