C21H21N5O3S — CID 55646957
3-(2,3-dihydroindol-1-ylsulfonyl)-N-[2-(pyrimidin-2-ylamino)ethyl]benzamide (PubChem CID 55646957) has the molecular formula C21H21N5O3S and a molecular weight of 423.50 g/mol. Its IUPAC name is 3-(2,3-dihydroindol-1-ylsulfonyl)-N-[2-(pyrimidin-2-ylamino)ethyl]benzamide.
| Compound Name | 3-(2,3-dihydroindol-1-ylsulfonyl)-N-[2-(pyrimidin-2-ylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 55646957 |
| Molecular Formula | C21H21N5O3S |
| Molecular Weight | 423.50 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | 3-(2,3-dihydroindol-1-ylsulfonyl)-N-[2-(pyrimidin-2-ylamino)ethyl]benzamide |
| SMILES | O=C(NCCNc1ncccn1)c1cccc(S(=O)(=O)N2CCc3ccccc32)c1 |
| InChI | InChI=1S/C21H21N5O3S/c27-20(22-12-13-25-21-23-10-4-11-24-21)17-6-3-7-18(15-17)30(28,29)26-14-9-16-5-1-2-8-19(16)26/h1-8,10-11,15H,9,12-14H2,(H,22,27)(H,23,24,25) |
| InChIKey | KSRAEGJNLGBGRR-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.50 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|