C20H24N4O3S — CID 9204710
3-(2,3-dihydroindol-1-ylsulfonyl)-N-(4-methylpiperazin-1-yl)benzamide (PubChem CID 9204710) has the molecular formula C20H24N4O3S and a molecular weight of 400.50 g/mol. Its IUPAC name is 3-(2,3-dihydroindol-1-ylsulfonyl)-N-(4-methylpiperazin-1-yl)benzamide.
| Compound Name | 3-(2,3-dihydroindol-1-ylsulfonyl)-N-(4-methylpiperazin-1-yl)benzamide |
|---|---|
| PubChem CID | 9204710 |
| Molecular Formula | C20H24N4O3S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 3-(2,3-dihydroindol-1-ylsulfonyl)-N-(4-methylpiperazin-1-yl)benzamide |
| SMILES | CN1CCN(NC(=O)c2cccc(S(=O)(=O)N3CCc4ccccc43)c2)CC1 |
| InChI | InChI=1S/C20H24N4O3S/c1-22-11-13-23(14-12-22)21-20(25)17-6-4-7-18(15-17)28(26,27)24-10-9-16-5-2-3-8-19(16)24/h2-8,15H,9-14H2,1H3,(H,21,25) |
| InChIKey | WXNVNFMRVAROFH-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |