C24H24N2O3S — CID 7958230
3-(2,3-dihydroindol-1-ylsulfonyl)-N-(2-propan-2-ylphenyl)benzamide (PubChem CID 7958230) has the molecular formula C24H24N2O3S and a molecular weight of 420.53 g/mol. Its IUPAC name is 3-(2,3-dihydroindol-1-ylsulfonyl)-N-(2-propan-2-ylphenyl)benzamide.
| Compound Name | 3-(2,3-dihydroindol-1-ylsulfonyl)-N-(2-propan-2-ylphenyl)benzamide |
|---|---|
| PubChem CID | 7958230 |
| Molecular Formula | C24H24N2O3S |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 3-(2,3-dihydroindol-1-ylsulfonyl)-N-(2-propan-2-ylphenyl)benzamide |
| SMILES | CC(C)c1ccccc1NC(=O)c1cccc(S(=O)(=O)N2CCc3ccccc32)c1 |
| InChI | InChI=1S/C24H24N2O3S/c1-17(2)21-11-4-5-12-22(21)25-24(27)19-9-7-10-20(16-19)30(28,29)26-15-14-18-8-3-6-13-23(18)26/h3-13,16-17H,14-15H2,1-2H3,(H,25,27) |
| InChIKey | JNRPMALAGOQDGE-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |