C21H22N4O3S — CID 86961299
3-(2,3-dihydroindol-1-ylsulfonyl)-N-(3-ethyl-1-methylpyrazol-5-yl)benzamide (PubChem CID 86961299) has the molecular formula C21H22N4O3S and a molecular weight of 410.50 g/mol. Its IUPAC name is 3-(2,3-dihydroindol-1-ylsulfonyl)-N-(3-ethyl-1-methylpyrazol-5-yl)benzamide.
| Compound Name | 3-(2,3-dihydroindol-1-ylsulfonyl)-N-(3-ethyl-1-methylpyrazol-5-yl)benzamide |
|---|---|
| PubChem CID | 86961299 |
| Molecular Formula | C21H22N4O3S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 3-(2,3-dihydroindol-1-ylsulfonyl)-N-(3-ethyl-1-methylpyrazol-5-yl)benzamide |
| SMILES | CCc1cc(NC(=O)c2cccc(S(=O)(=O)N3CCc4ccccc43)c2)n(C)n1 |
| InChI | InChI=1S/C21H22N4O3S/c1-3-17-14-20(24(2)23-17)22-21(26)16-8-6-9-18(13-16)29(27,28)25-12-11-15-7-4-5-10-19(15)25/h4-10,13-14H,3,11-12H2,1-2H3,(H,22,26) |
| InChIKey | QZCYUNPLCPGQHV-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |