C24H23N3O4S — CID 39132073
3-[[3-(2,3-dihydroindol-1-ylsulfonyl)benzoyl]amino]-N,4-dimethylbenzamide (PubChem CID 39132073) has the molecular formula C24H23N3O4S and a molecular weight of 449.53 g/mol. Its IUPAC name is 3-[[3-(2,3-dihydroindol-1-ylsulfonyl)benzoyl]amino]-N,4-dimethylbenzamide.
| Compound Name | 3-[[3-(2,3-dihydroindol-1-ylsulfonyl)benzoyl]amino]-N,4-dimethylbenzamide |
|---|---|
| PubChem CID | 39132073 |
| Molecular Formula | C24H23N3O4S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | 3-[[3-(2,3-dihydroindol-1-ylsulfonyl)benzoyl]amino]-N,4-dimethylbenzamide |
| SMILES | CNC(=O)c1ccc(C)c(NC(=O)c2cccc(S(=O)(=O)N3CCc4ccccc43)c2)c1 |
| InChI | InChI=1S/C24H23N3O4S/c1-16-10-11-19(23(28)25-2)15-21(16)26-24(29)18-7-5-8-20(14-18)32(30,31)27-13-12-17-6-3-4-9-22(17)27/h3-11,14-15H,12-13H2,1-2H3,(H,25,28)(H,26,29) |
| InChIKey | XPWBDUCNNCRHLO-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |