C20H25N4O3S+ — CID 9204709
3-(2,3-dihydroindol-1-ylsulfonyl)-N-(4-methylpiperazin-4-ium-1-yl)benzamide (PubChem CID 9204709) has the molecular formula C20H25N4O3S+ and a molecular weight of 401.51 g/mol. Its IUPAC name is 3-(2,3-dihydroindol-1-ylsulfonyl)-N-(4-methylpiperazin-4-ium-1-yl)benzamide.
| Compound Name | 3-(2,3-dihydroindol-1-ylsulfonyl)-N-(4-methylpiperazin-4-ium-1-yl)benzamide |
|---|---|
| PubChem CID | 9204709 |
| Molecular Formula | C20H25N4O3S+ |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | 3-(2,3-dihydroindol-1-ylsulfonyl)-N-(4-methylpiperazin-4-ium-1-yl)benzamide |
| SMILES | C[NH+]1CCN(NC(=O)c2cccc(S(=O)(=O)N3CCc4ccccc43)c2)CC1 |
| InChI | InChI=1S/C20H24N4O3S/c1-22-11-13-23(14-12-22)21-20(25)17-6-4-7-18(15-17)28(26,27)24-10-9-16-5-2-3-8-19(16)24/h2-8,15H,9-14H2,1H3,(H,21,25)/p+1 |
| InChIKey | WXNVNFMRVAROFH-UHFFFAOYSA-O |
| XLogP | -0.09 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |