C22H21N3O3S — CID 55341761
3-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)-N-(pyridin-2-ylmethyl)benzamide (PubChem CID 55341761) has the molecular formula C22H21N3O3S and a molecular weight of 407.50 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)-N-(pyridin-2-ylmethyl)benzamide.
| Compound Name | 3-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)-N-(pyridin-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 55341761 |
| Molecular Formula | C22H21N3O3S |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 3-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)-N-(pyridin-2-ylmethyl)benzamide |
| SMILES | O=C(NCc1ccccn1)c1cccc(S(=O)(=O)N2CCCc3ccccc32)c1 |
| InChI | InChI=1S/C22H21N3O3S/c26-22(24-16-19-10-3-4-13-23-19)18-8-5-11-20(15-18)29(27,28)25-14-6-9-17-7-1-2-12-21(17)25/h1-5,7-8,10-13,15H,6,9,14,16H2,(H,24,26) |
| InChIKey | NWVXHNUQXIGLHW-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |