C21H18N2O4S — CID 40711757
pyridin-2-ylmethyl 3-(2,3-dihydroindol-1-ylsulfonyl)benzoate (PubChem CID 40711757) has the molecular formula C21H18N2O4S and a molecular weight of 394.45 g/mol. Its IUPAC name is pyridin-2-ylmethyl 3-(2,3-dihydroindol-1-ylsulfonyl)benzoate.
| Compound Name | pyridin-2-ylmethyl 3-(2,3-dihydroindol-1-ylsulfonyl)benzoate |
|---|---|
| PubChem CID | 40711757 |
| Molecular Formula | C21H18N2O4S |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | pyridin-2-ylmethyl 3-(2,3-dihydroindol-1-ylsulfonyl)benzoate |
| SMILES | O=C(OCc1ccccn1)c1cccc(S(=O)(=O)N2CCc3ccccc32)c1 |
| InChI | InChI=1S/C21H18N2O4S/c24-21(27-15-18-8-3-4-12-22-18)17-7-5-9-19(14-17)28(25,26)23-13-11-16-6-1-2-10-20(16)23/h1-10,12,14H,11,13,15H2 |
| InChIKey | ADXMDWNUDBRNGV-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |