C21H24N2O5S — CID 2406740
[2-(tert-butylamino)-2-oxoethyl] 3-(2,3-dihydroindol-1-ylsulfonyl)benzoate (PubChem CID 2406740) has the molecular formula C21H24N2O5S and a molecular weight of 416.50 g/mol. Its IUPAC name is [2-(tert-butylamino)-2-oxoethyl] 3-(2,3-dihydroindol-1-ylsulfonyl)benzoate.
| Compound Name | [2-(tert-butylamino)-2-oxoethyl] 3-(2,3-dihydroindol-1-ylsulfonyl)benzoate |
|---|---|
| PubChem CID | 2406740 |
| Molecular Formula | C21H24N2O5S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | [2-(tert-butylamino)-2-oxoethyl] 3-(2,3-dihydroindol-1-ylsulfonyl)benzoate |
| SMILES | CC(C)(C)NC(=O)COC(=O)c1cccc(S(=O)(=O)N2CCc3ccccc32)c1 |
| InChI | InChI=1S/C21H24N2O5S/c1-21(2,3)22-19(24)14-28-20(25)16-8-6-9-17(13-16)29(26,27)23-12-11-15-7-4-5-10-18(15)23/h4-10,13H,11-12,14H2,1-3H3,(H,22,24) |
| InChIKey | CTHYAJYPMJOCIP-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |