C26H29N3O3S — CID 24542710
3-(2,3-dihydroindol-1-ylsulfonyl)-N-[2-(dimethylamino)-3-phenylpropyl]benzamide (PubChem CID 24542710) has the molecular formula C26H29N3O3S and a molecular weight of 463.60 g/mol. Its IUPAC name is 3-(2,3-dihydroindol-1-ylsulfonyl)-N-[2-(dimethylamino)-3-phenylpropyl]benzamide.
| Compound Name | 3-(2,3-dihydroindol-1-ylsulfonyl)-N-[2-(dimethylamino)-3-phenylpropyl]benzamide |
|---|---|
| PubChem CID | 24542710 |
| Molecular Formula | C26H29N3O3S |
| Molecular Weight | 463.60 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | 3-(2,3-dihydroindol-1-ylsulfonyl)-N-[2-(dimethylamino)-3-phenylpropyl]benzamide |
| SMILES | CN(C)C(CNC(=O)c1cccc(S(=O)(=O)N2CCc3ccccc32)c1)Cc1ccccc1 |
| InChI | InChI=1S/C26H29N3O3S/c1-28(2)23(17-20-9-4-3-5-10-20)19-27-26(30)22-12-8-13-24(18-22)33(31,32)29-16-15-21-11-6-7-14-25(21)29/h3-14,18,23H,15-17,19H2,1-2H3,(H,27,30) |
| InChIKey | OENNTDOQDJUVFV-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.60 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |