C15H15NO4S2 — CID 6462869
1-(3-methylsulfonylphenyl)sulfonyl-2,3-dihydroindole (PubChem CID 6462869) has the molecular formula C15H15NO4S2 and a molecular weight of 337.42 g/mol. Its IUPAC name is 1-(3-methylsulfonylphenyl)sulfonyl-2,3-dihydroindole.
| Compound Name | 1-(3-methylsulfonylphenyl)sulfonyl-2,3-dihydroindole |
|---|---|
| PubChem CID | 6462869 |
| Molecular Formula | C15H15NO4S2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | 1-(3-methylsulfonylphenyl)sulfonyl-2,3-dihydroindole |
| SMILES | CS(=O)(=O)c1cccc(S(=O)(=O)N2CCc3ccccc32)c1 |
| InChI | InChI=1S/C15H15NO4S2/c1-21(17,18)13-6-4-7-14(11-13)22(19,20)16-10-9-12-5-2-3-8-15(12)16/h2-8,11H,9-10H2,1H3 |
| InChIKey | JVTZUOGHCYBBRJ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |