C18H20N2O4S2 — CID 43811959
1-(3-pyrrolidin-1-ylsulfonylphenyl)sulfonyl-2,3-dihydroindole (PubChem CID 43811959) has the molecular formula C18H20N2O4S2 and a molecular weight of 392.50 g/mol. Its IUPAC name is 1-(3-pyrrolidin-1-ylsulfonylphenyl)sulfonyl-2,3-dihydroindole.
| Compound Name | 1-(3-pyrrolidin-1-ylsulfonylphenyl)sulfonyl-2,3-dihydroindole |
|---|---|
| PubChem CID | 43811959 |
| Molecular Formula | C18H20N2O4S2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | 1-(3-pyrrolidin-1-ylsulfonylphenyl)sulfonyl-2,3-dihydroindole |
| SMILES | O=S(=O)(c1cccc(S(=O)(=O)N2CCc3ccccc32)c1)N1CCCC1 |
| InChI | InChI=1S/C18H20N2O4S2/c21-25(22,19-11-3-4-12-19)16-7-5-8-17(14-16)26(23,24)20-13-10-15-6-1-2-9-18(15)20/h1-2,5-9,14H,3-4,10-13H2 |
| InChIKey | XUMVJOGLYPOVMD-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |