C21H24N2O3S — CID 1202064
[3-(azepan-1-ylsulfonyl)phenyl]-(2,3-dihydroindol-1-yl)methanone (PubChem CID 1202064) has the molecular formula C21H24N2O3S and a molecular weight of 384.50 g/mol. Its IUPAC name is [3-(azepan-1-ylsulfonyl)phenyl]-(2,3-dihydroindol-1-yl)methanone.
| Compound Name | [3-(azepan-1-ylsulfonyl)phenyl]-(2,3-dihydroindol-1-yl)methanone |
|---|---|
| PubChem CID | 1202064 |
| Molecular Formula | C21H24N2O3S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | [3-(azepan-1-ylsulfonyl)phenyl]-(2,3-dihydroindol-1-yl)methanone |
| SMILES | O=C(c1cccc(S(=O)(=O)N2CCCCCC2)c1)N1CCc2ccccc21 |
| InChI | InChI=1S/C21H24N2O3S/c24-21(23-15-12-17-8-3-4-11-20(17)23)18-9-7-10-19(16-18)27(25,26)22-13-5-1-2-6-14-22/h3-4,7-11,16H,1-2,5-6,12-15H2 |
| InChIKey | HMQXVXJMXPWACC-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |