C20H21FN2O3S — CID 26681076
2,3-dihydroindol-1-yl-(4-fluoro-3-piperidin-1-ylsulfonylphenyl)methanone (PubChem CID 26681076) has the molecular formula C20H21FN2O3S and a molecular weight of 388.46 g/mol. Its IUPAC name is 2,3-dihydroindol-1-yl-(4-fluoro-3-piperidin-1-ylsulfonylphenyl)methanone.
| Compound Name | 2,3-dihydroindol-1-yl-(4-fluoro-3-piperidin-1-ylsulfonylphenyl)methanone |
|---|---|
| PubChem CID | 26681076 |
| Molecular Formula | C20H21FN2O3S |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | 2,3-dihydroindol-1-yl-(4-fluoro-3-piperidin-1-ylsulfonylphenyl)methanone |
| SMILES | O=C(c1ccc(F)c(S(=O)(=O)N2CCCCC2)c1)N1CCc2ccccc21 |
| InChI | InChI=1S/C20H21FN2O3S/c21-17-9-8-16(14-19(17)27(25,26)22-11-4-1-5-12-22)20(24)23-13-10-15-6-2-3-7-18(15)23/h2-3,6-9,14H,1,4-5,10-13H2 |
| InChIKey | XQTVABAAWOXEQB-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |