C12H16N2O2S — CID 110705798
1-pyrrolidin-1-ylsulfonyl-2,3-dihydroindole (PubChem CID 110705798) has the molecular formula C12H16N2O2S and a molecular weight of 252.34 g/mol. Its IUPAC name is 1-pyrrolidin-1-ylsulfonyl-2,3-dihydroindole.
| Compound Name | 1-pyrrolidin-1-ylsulfonyl-2,3-dihydroindole |
|---|---|
| PubChem CID | 110705798 |
| Molecular Formula | C12H16N2O2S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 1-pyrrolidin-1-ylsulfonyl-2,3-dihydroindole |
| SMILES | O=S(=O)(N1CCCC1)N1CCc2ccccc21 |
| InChI | InChI=1S/C12H16N2O2S/c15-17(16,13-8-3-4-9-13)14-10-7-11-5-1-2-6-12(11)14/h1-2,5-6H,3-4,7-10H2 |
| InChIKey | MJYYUSBJXUHGHY-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |