C15H21N3O3S — CID 110865632
1-[4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)piperazin-1-yl]ethanone (PubChem CID 110865632) has the molecular formula C15H21N3O3S and a molecular weight of 323.42 g/mol. Its IUPAC name is 1-[4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)piperazin-1-yl]ethanone.
| Compound Name | 1-[4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 110865632 |
| Molecular Formula | C15H21N3O3S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 1-[4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(S(=O)(=O)N2CCCc3ccccc32)CC1 |
| InChI | InChI=1S/C15H21N3O3S/c1-13(19)16-9-11-17(12-10-16)22(20,21)18-8-4-6-14-5-2-3-7-15(14)18/h2-3,5,7H,4,6,8-12H2,1H3 |
| InChIKey | GKCAXVAAOOYUJE-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |