C10H10F3NO2S — CID 15836554
1-(trifluoromethylsulfonyl)-3,4-dihydro-2H-quinoline (PubChem CID 15836554) has the molecular formula C10H10F3NO2S and a molecular weight of 265.26 g/mol. Its IUPAC name is 1-(trifluoromethylsulfonyl)-3,4-dihydro-2H-quinoline.
| Compound Name | 1-(trifluoromethylsulfonyl)-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 15836554 |
| Molecular Formula | C10H10F3NO2S |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.04 |
| IUPAC Name | 1-(trifluoromethylsulfonyl)-3,4-dihydro-2H-quinoline |
| SMILES | O=S(=O)(N1CCCc2ccccc21)C(F)(F)F |
| InChI | InChI=1S/C10H10F3NO2S/c11-10(12,13)17(15,16)14-7-3-5-8-4-1-2-6-9(8)14/h1-2,4,6H,3,5,7H2 |
| InChIKey | SRSSFJIKWGZCDD-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |