C16H14F3NO3S — CID 3483007
1-[2-(trifluoromethoxy)phenyl]sulfonyl-3,4-dihydro-2H-quinoline (PubChem CID 3483007) has the molecular formula C16H14F3NO3S and a molecular weight of 357.35 g/mol. Its IUPAC name is 1-[2-(trifluoromethoxy)phenyl]sulfonyl-3,4-dihydro-2H-quinoline.
| Compound Name | 1-[2-(trifluoromethoxy)phenyl]sulfonyl-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 3483007 |
| Molecular Formula | C16H14F3NO3S |
| Molecular Weight | 357.35 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | 1-[2-(trifluoromethoxy)phenyl]sulfonyl-3,4-dihydro-2H-quinoline |
| SMILES | O=S(=O)(c1ccccc1OC(F)(F)F)N1CCCc2ccccc21 |
| InChI | InChI=1S/C16H14F3NO3S/c17-16(18,19)23-14-9-3-4-10-15(14)24(21,22)20-11-5-7-12-6-1-2-8-13(12)20/h1-4,6,8-10H,5,7,11H2 |
| InChIKey | HOHDXHHDCASHGI-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.35 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |