C16H13FNO4S- — CID 9160527
3-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)-4-fluorobenzoate (PubChem CID 9160527) has the molecular formula C16H13FNO4S- and a molecular weight of 334.35 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)-4-fluorobenzoate.
| Compound Name | 3-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)-4-fluorobenzoate |
|---|---|
| PubChem CID | 9160527 |
| Molecular Formula | C16H13FNO4S- |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 3-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)-4-fluorobenzoate |
| SMILES | O=C([O-])c1ccc(F)c(S(=O)(=O)N2CCCc3ccccc32)c1 |
| InChI | InChI=1S/C16H14FNO4S/c17-13-8-7-12(16(19)20)10-15(13)23(21,22)18-9-3-5-11-4-1-2-6-14(11)18/h1-2,4,6-8,10H,3,5,9H2,(H,19,20)/p-1 |
| InChIKey | KXFGDQNDNYRXTQ-UHFFFAOYSA-M |
| XLogP | 1.33 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |