C17H17NO4S — CID 9235357
3-(2,3-dihydroindol-1-ylsulfonyl)-4,5-dimethylbenzoic acid (PubChem CID 9235357) has the molecular formula C17H17NO4S and a molecular weight of 331.39 g/mol. Its IUPAC name is 3-(2,3-dihydroindol-1-ylsulfonyl)-4,5-dimethylbenzoic acid.
| Compound Name | 3-(2,3-dihydroindol-1-ylsulfonyl)-4,5-dimethylbenzoic acid |
|---|---|
| PubChem CID | 9235357 |
| Molecular Formula | C17H17NO4S |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | 3-(2,3-dihydroindol-1-ylsulfonyl)-4,5-dimethylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)cc(S(=O)(=O)N2CCc3ccccc32)c1C |
| InChI | InChI=1S/C17H17NO4S/c1-11-9-14(17(19)20)10-16(12(11)2)23(21,22)18-8-7-13-5-3-4-6-15(13)18/h3-6,9-10H,7-8H2,1-2H3,(H,19,20) |
| InChIKey | TVJNLRXQCKBREF-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |