C18H18ClNO4S — CID 24530655
propyl 4-chloro-3-(2,3-dihydroindol-1-ylsulfonyl)benzoate (PubChem CID 24530655) has the molecular formula C18H18ClNO4S and a molecular weight of 379.87 g/mol. Its IUPAC name is propyl 4-chloro-3-(2,3-dihydroindol-1-ylsulfonyl)benzoate.
| Compound Name | propyl 4-chloro-3-(2,3-dihydroindol-1-ylsulfonyl)benzoate |
|---|---|
| PubChem CID | 24530655 |
| Molecular Formula | C18H18ClNO4S |
| Molecular Weight | 379.87 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | propyl 4-chloro-3-(2,3-dihydroindol-1-ylsulfonyl)benzoate |
| SMILES | CCCOC(=O)c1ccc(Cl)c(S(=O)(=O)N2CCc3ccccc32)c1 |
| InChI | InChI=1S/C18H18ClNO4S/c1-2-11-24-18(21)14-7-8-15(19)17(12-14)25(22,23)20-10-9-13-5-3-4-6-16(13)20/h3-8,12H,2,9-11H2,1H3 |
| InChIKey | VXTHZIHWTQQDDZ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.87 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |