C25H18ClNO4S — CID 4599470
naphthalen-2-yl 4-chloro-3-(2,3-dihydroindol-1-ylsulfonyl)benzoate (PubChem CID 4599470) has the molecular formula C25H18ClNO4S and a molecular weight of 463.94 g/mol. Its IUPAC name is naphthalen-2-yl 4-chloro-3-(2,3-dihydroindol-1-ylsulfonyl)benzoate.
| Compound Name | naphthalen-2-yl 4-chloro-3-(2,3-dihydroindol-1-ylsulfonyl)benzoate |
|---|---|
| PubChem CID | 4599470 |
| Molecular Formula | C25H18ClNO4S |
| Molecular Weight | 463.94 g/mol |
| Exact Mass | 463.06 |
| IUPAC Name | naphthalen-2-yl 4-chloro-3-(2,3-dihydroindol-1-ylsulfonyl)benzoate |
| SMILES | O=C(Oc1ccc2ccccc2c1)c1ccc(Cl)c(S(=O)(=O)N2CCc3ccccc32)c1 |
| InChI | InChI=1S/C25H18ClNO4S/c26-22-12-10-20(25(28)31-21-11-9-17-5-1-2-7-19(17)15-21)16-24(22)32(29,30)27-14-13-18-6-3-4-8-23(18)27/h1-12,15-16H,13-14H2 |
| InChIKey | OUWWAFPGTABTIL-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.94 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|