C23H22ClNO5S — CID 16552080
naphthalen-2-yl 4-chloro-3-(2,6-dimethylmorpholin-4-yl)sulfonylbenzoate (PubChem CID 16552080) has the molecular formula C23H22ClNO5S and a molecular weight of 459.95 g/mol. Its IUPAC name is naphthalen-2-yl 4-chloro-3-(2,6-dimethylmorpholin-4-yl)sulfonylbenzoate.
| Compound Name | naphthalen-2-yl 4-chloro-3-(2,6-dimethylmorpholin-4-yl)sulfonylbenzoate |
|---|---|
| PubChem CID | 16552080 |
| Molecular Formula | C23H22ClNO5S |
| Molecular Weight | 459.95 g/mol |
| Exact Mass | 459.09 |
| IUPAC Name | naphthalen-2-yl 4-chloro-3-(2,6-dimethylmorpholin-4-yl)sulfonylbenzoate |
| SMILES | CC1CN(S(=O)(=O)c2cc(C(=O)Oc3ccc4ccccc4c3)ccc2Cl)CC(C)O1 |
| InChI | InChI=1S/C23H22ClNO5S/c1-15-13-25(14-16(2)29-15)31(27,28)22-12-19(8-10-21(22)24)23(26)30-20-9-7-17-5-3-4-6-18(17)11-20/h3-12,15-16H,13-14H2,1-2H3 |
| InChIKey | CNEQDGYLJZMGRT-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.95 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|