C23H26ClNO6S3 — CID 16561360
[4-(1,3-dithiolan-2-yl)-2-methoxyphenyl] 4-chloro-3-(2,6-dimethylmorpholin-4-yl)sulfonylbenzoate (PubChem CID 16561360) has the molecular formula C23H26ClNO6S3 and a molecular weight of 544.12 g/mol. Its IUPAC name is [4-(1,3-dithiolan-2-yl)-2-methoxyphenyl] 4-chloro-3-(2,6-dimethylmorpholin-4-yl)sulfonylbenzoate.
| Compound Name | [4-(1,3-dithiolan-2-yl)-2-methoxyphenyl] 4-chloro-3-(2,6-dimethylmorpholin-4-yl)sulfonylbenzoate |
|---|---|
| PubChem CID | 16561360 |
| Molecular Formula | C23H26ClNO6S3 |
| Molecular Weight | 544.12 g/mol |
| Exact Mass | 543.06 |
| IUPAC Name | [4-(1,3-dithiolan-2-yl)-2-methoxyphenyl] 4-chloro-3-(2,6-dimethylmorpholin-4-yl)sulfonylbenzoate |
| SMILES | COc1cc(C2SCCS2)ccc1OC(=O)c1ccc(Cl)c(S(=O)(=O)N2CC(C)OC(C)C2)c1 |
| InChI | InChI=1S/C23H26ClNO6S3/c1-14-12-25(13-15(2)30-14)34(27,28)21-11-16(4-6-18(21)24)22(26)31-19-7-5-17(10-20(19)29-3)23-32-8-9-33-23/h4-7,10-11,14-15,23H,8-9,12-13H2,1-3H3 |
| InChIKey | RDAVRLHCKYFSHK-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.12 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|