C21H23NO5S3 — CID 16562030
[4-(1,3-dithiolan-2-yl)-2-methoxyphenyl] 2-methyl-1-methylsulfonyl-2,3-dihydroindole-5-carboxylate (PubChem CID 16562030) has the molecular formula C21H23NO5S3 and a molecular weight of 465.62 g/mol. Its IUPAC name is [4-(1,3-dithiolan-2-yl)-2-methoxyphenyl] 2-methyl-1-methylsulfonyl-2,3-dihydroindole-5-carboxylate.
| Compound Name | [4-(1,3-dithiolan-2-yl)-2-methoxyphenyl] 2-methyl-1-methylsulfonyl-2,3-dihydroindole-5-carboxylate |
|---|---|
| PubChem CID | 16562030 |
| Molecular Formula | C21H23NO5S3 |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.07 |
| IUPAC Name | [4-(1,3-dithiolan-2-yl)-2-methoxyphenyl] 2-methyl-1-methylsulfonyl-2,3-dihydroindole-5-carboxylate |
| SMILES | COc1cc(C2SCCS2)ccc1OC(=O)c1ccc2c(c1)CC(C)N2S(C)(=O)=O |
| InChI | InChI=1S/C21H23NO5S3/c1-13-10-16-11-14(4-6-17(16)22(13)30(3,24)25)20(23)27-18-7-5-15(12-19(18)26-2)21-28-8-9-29-21/h4-7,11-13,21H,8-10H2,1-3H3 |
| InChIKey | QTFHFMKOVLKXGL-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|