C19H21NO4S — CID 8777244
(2,6-dimethylphenyl) (2R)-2-methyl-1-methylsulfonyl-2,3-dihydroindole-5-carboxylate (PubChem CID 8777244) has the molecular formula C19H21NO4S and a molecular weight of 359.45 g/mol. Its IUPAC name is (2,6-dimethylphenyl) (2R)-2-methyl-1-methylsulfonyl-2,3-dihydroindole-5-carboxylate.
| Compound Name | (2,6-dimethylphenyl) (2R)-2-methyl-1-methylsulfonyl-2,3-dihydroindole-5-carboxylate |
|---|---|
| PubChem CID | 8777244 |
| Molecular Formula | C19H21NO4S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | (2,6-dimethylphenyl) (2R)-2-methyl-1-methylsulfonyl-2,3-dihydroindole-5-carboxylate |
| SMILES | Cc1cccc(C)c1OC(=O)c1ccc2c(c1)C[C@@H](C)N2S(C)(=O)=O |
| InChI | InChI=1S/C19H21NO4S/c1-12-6-5-7-13(2)18(12)24-19(21)15-8-9-17-16(11-15)10-14(3)20(17)25(4,22)23/h5-9,11,14H,10H2,1-4H3/t14-/m1/s1 |
| InChIKey | ZHVITNFQDFGMRI-CQSZACIVSA-N |
| XLogP | 3.23 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|