C18H17NO6S — CID 8777256
1,3-benzodioxol-5-yl (2R)-2-methyl-1-methylsulfonyl-2,3-dihydroindole-5-carboxylate (PubChem CID 8777256) has the molecular formula C18H17NO6S and a molecular weight of 375.40 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl (2R)-2-methyl-1-methylsulfonyl-2,3-dihydroindole-5-carboxylate.
| Compound Name | 1,3-benzodioxol-5-yl (2R)-2-methyl-1-methylsulfonyl-2,3-dihydroindole-5-carboxylate |
|---|---|
| PubChem CID | 8777256 |
| Molecular Formula | C18H17NO6S |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | 1,3-benzodioxol-5-yl (2R)-2-methyl-1-methylsulfonyl-2,3-dihydroindole-5-carboxylate |
| SMILES | C[C@@H]1Cc2cc(C(=O)Oc3ccc4c(c3)OCO4)ccc2N1S(C)(=O)=O |
| InChI | InChI=1S/C18H17NO6S/c1-11-7-13-8-12(3-5-15(13)19(11)26(2,21)22)18(20)25-14-4-6-16-17(9-14)24-10-23-16/h3-6,8-9,11H,7,10H2,1-2H3/t11-/m1/s1 |
| InChIKey | XKDGRZMYVBXWIZ-LLVKDONJSA-N |
| XLogP | 2.35 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|