C24H22N2O5S — CID 55383877
(4-benzamidophenyl) 2-methyl-1-methylsulfonyl-2,3-dihydroindole-5-carboxylate (PubChem CID 55383877) has the molecular formula C24H22N2O5S and a molecular weight of 450.52 g/mol. Its IUPAC name is (4-benzamidophenyl) 2-methyl-1-methylsulfonyl-2,3-dihydroindole-5-carboxylate.
| Compound Name | (4-benzamidophenyl) 2-methyl-1-methylsulfonyl-2,3-dihydroindole-5-carboxylate |
|---|---|
| PubChem CID | 55383877 |
| Molecular Formula | C24H22N2O5S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | (4-benzamidophenyl) 2-methyl-1-methylsulfonyl-2,3-dihydroindole-5-carboxylate |
| SMILES | CC1Cc2cc(C(=O)Oc3ccc(NC(=O)c4ccccc4)cc3)ccc2N1S(C)(=O)=O |
| InChI | InChI=1S/C24H22N2O5S/c1-16-14-19-15-18(8-13-22(19)26(16)32(2,29)30)24(28)31-21-11-9-20(10-12-21)25-23(27)17-6-4-3-5-7-17/h3-13,15-16H,14H2,1-2H3,(H,25,27) |
| InChIKey | YFBVLBRRTOIIOF-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|