C23H29N3O3S — CID 9279034
(2S)-N-[4-(azepan-1-yl)phenyl]-2-methyl-1-methylsulfonyl-2,3-dihydroindole-5-carboxamide (PubChem CID 9279034) has the molecular formula C23H29N3O3S and a molecular weight of 427.57 g/mol. Its IUPAC name is (2S)-N-[4-(azepan-1-yl)phenyl]-2-methyl-1-methylsulfonyl-2,3-dihydroindole-5-carboxamide.
| Compound Name | (2S)-N-[4-(azepan-1-yl)phenyl]-2-methyl-1-methylsulfonyl-2,3-dihydroindole-5-carboxamide |
|---|---|
| PubChem CID | 9279034 |
| Molecular Formula | C23H29N3O3S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | (2S)-N-[4-(azepan-1-yl)phenyl]-2-methyl-1-methylsulfonyl-2,3-dihydroindole-5-carboxamide |
| SMILES | C[C@H]1Cc2cc(C(=O)Nc3ccc(N4CCCCCC4)cc3)ccc2N1S(C)(=O)=O |
| InChI | InChI=1S/C23H29N3O3S/c1-17-15-19-16-18(7-12-22(19)26(17)30(2,28)29)23(27)24-20-8-10-21(11-9-20)25-13-5-3-4-6-14-25/h7-12,16-17H,3-6,13-15H2,1-2H3,(H,24,27)/t17-/m0/s1 |
| InChIKey | WNTTZIJQCFZFHU-KRWDZBQOSA-N |
| XLogP | 4.03 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|