C18H25N3O4S — CID 9327258
(2S)-N'-(cyclohexanecarbonyl)-2-methyl-1-methylsulfonyl-2,3-dihydroindole-5-carbohydrazide (PubChem CID 9327258) has the molecular formula C18H25N3O4S and a molecular weight of 379.48 g/mol. Its IUPAC name is (2S)-N'-(cyclohexanecarbonyl)-2-methyl-1-methylsulfonyl-2,3-dihydroindole-5-carbohydrazide.
| Compound Name | (2S)-N'-(cyclohexanecarbonyl)-2-methyl-1-methylsulfonyl-2,3-dihydroindole-5-carbohydrazide |
|---|---|
| PubChem CID | 9327258 |
| Molecular Formula | C18H25N3O4S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | (2S)-N'-(cyclohexanecarbonyl)-2-methyl-1-methylsulfonyl-2,3-dihydroindole-5-carbohydrazide |
| SMILES | C[C@H]1Cc2cc(C(=O)NNC(=O)C3CCCCC3)ccc2N1S(C)(=O)=O |
| InChI | InChI=1S/C18H25N3O4S/c1-12-10-15-11-14(8-9-16(15)21(12)26(2,24)25)18(23)20-19-17(22)13-6-4-3-5-7-13/h8-9,11-13H,3-7,10H2,1-2H3,(H,19,22)(H,20,23)/t12-/m0/s1 |
| InChIKey | VJQYGWJIHBXREY-LBPRGKRZSA-N |
| XLogP | 1.74 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|