C22H27N3O4S2 — CID 46656696
N'-(4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbonyl)-2-methyl-1-methylsulfonyl-2,3-dihydroindole-5-carbohydrazide (PubChem CID 46656696) has the molecular formula C22H27N3O4S2 and a molecular weight of 461.61 g/mol. Its IUPAC name is N'-(4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbonyl)-2-methyl-1-methylsulfonyl-2,3-dihydroindole-5-carbohydrazide.
| Compound Name | N'-(4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbonyl)-2-methyl-1-methylsulfonyl-2,3-dihydroindole-5-carbohydrazide |
|---|---|
| PubChem CID | 46656696 |
| Molecular Formula | C22H27N3O4S2 |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | N'-(4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbonyl)-2-methyl-1-methylsulfonyl-2,3-dihydroindole-5-carbohydrazide |
| SMILES | CC1Cc2cc(C(=O)NNC(=O)c3cc4c(s3)CCCCCC4)ccc2N1S(C)(=O)=O |
| InChI | InChI=1S/C22H27N3O4S2/c1-14-11-17-12-16(9-10-18(17)25(14)31(2,28)29)21(26)23-24-22(27)20-13-15-7-5-3-4-6-8-19(15)30-20/h9-10,12-14H,3-8,11H2,1-2H3,(H,23,26)(H,24,27) |
| InChIKey | WHOQITUEASQKGJ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|