C19H22N2O4S2 — CID 25443653
N'-(3-methylsulfonylbenzoyl)-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbohydrazide (PubChem CID 25443653) has the molecular formula C19H22N2O4S2 and a molecular weight of 406.53 g/mol. Its IUPAC name is N'-(3-methylsulfonylbenzoyl)-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbohydrazide.
| Compound Name | N'-(3-methylsulfonylbenzoyl)-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 25443653 |
| Molecular Formula | C19H22N2O4S2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | N'-(3-methylsulfonylbenzoyl)-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbohydrazide |
| SMILES | CS(=O)(=O)c1cccc(C(=O)NNC(=O)c2cc3c(s2)CCCCCC3)c1 |
| InChI | InChI=1S/C19H22N2O4S2/c1-27(24,25)15-9-6-8-14(11-15)18(22)20-21-19(23)17-12-13-7-4-2-3-5-10-16(13)26-17/h6,8-9,11-12H,2-5,7,10H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | WOJVCHSPZMFTIK-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|